C22H26N2O4S — CID 108558753
2-(3,4-dimethoxyphenyl)-N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]acetamide (PubChem CID 108558753) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108558753 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]acetamide |
| SMILES | COc1ccc(CC(=O)NC2CCN(C(=O)c3ccccc3S)CC2)cc1OC |
| InChI | InChI=1S/C22H26N2O4S/c1-27-18-8-7-15(13-19(18)28-2)14-21(25)23-16-9-11-24(12-10-16)22(26)17-5-3-4-6-20(17)29/h3-8,13,16,29H,9-12,14H2,1-2H3,(H,23,25) |
| InChIKey | ANVBKIKZSHHZRJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|