C24H30N2O6 — CID 108558731
N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 108558731) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 108558731 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(NC(=O)Cc3ccc(OC)c(OC)c3)CC2)c1 |
| InChI | InChI=1S/C24H30N2O6/c1-29-19-13-17(14-20(15-19)30-2)24(28)26-9-7-18(8-10-26)25-23(27)12-16-5-6-21(31-3)22(11-16)32-4/h5-6,11,13-15,18H,7-10,12H2,1-4H3,(H,25,27) |
| InChIKey | SQMSFFLWFAJLNV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |