C21H30N2O4 — CID 108935675
2-cyclopentyl-N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]acetamide (PubChem CID 108935675) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-cyclopentyl-N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108935675 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 2-cyclopentyl-N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]acetamide |
| SMILES | COc1ccc(C(=O)N2CCC(NC(=O)CC3CCCC3)CC2)cc1OC |
| InChI | InChI=1S/C21H30N2O4/c1-26-18-8-7-16(14-19(18)27-2)21(25)23-11-9-17(10-12-23)22-20(24)13-15-5-3-4-6-15/h7-8,14-15,17H,3-6,9-13H2,1-2H3,(H,22,24) |
| InChIKey | SXDYWQGHRFHHOY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |