C20H29N3O4 — CID 119330538
N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]piperidine-3-carboxamide (PubChem CID 119330538) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]piperidine-3-carboxamide.
| Compound Name | N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119330538 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]piperidine-3-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCC(NC(=O)C3CCCNC3)CC2)cc1OC |
| InChI | InChI=1S/C20H29N3O4/c1-26-17-6-5-14(12-18(17)27-2)20(25)23-10-7-16(8-11-23)22-19(24)15-4-3-9-21-13-15/h5-6,12,15-16,21H,3-4,7-11,13H2,1-2H3,(H,22,24) |
| InChIKey | UAIRAFBUIAYYPI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |