C18H25N3O4S — CID 119330522
N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]-1,3-thiazolidine-4-carboxamide (PubChem CID 119330522) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119330522 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]-1,3-thiazolidine-4-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCC(NC(=O)C3CSCN3)CC2)cc1OC |
| InChI | InChI=1S/C18H25N3O4S/c1-24-15-4-3-12(9-16(15)25-2)18(23)21-7-5-13(6-8-21)20-17(22)14-10-26-11-19-14/h3-4,9,13-14,19H,5-8,10-11H2,1-2H3,(H,20,22) |
| InChIKey | PTIKRAHTWNIPCQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |