C21H23ClN2O4 — CID 108548796
N-[1-(3-chlorobenzoyl)piperidin-4-yl]-3,4-dimethoxybenzamide (PubChem CID 108548796) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is N-[1-(3-chlorobenzoyl)piperidin-4-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[1-(3-chlorobenzoyl)piperidin-4-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 108548796 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-[1-(3-chlorobenzoyl)piperidin-4-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCN(C(=O)c3cccc(Cl)c3)CC2)cc1OC |
| InChI | InChI=1S/C21H23ClN2O4/c1-27-18-7-6-14(13-19(18)28-2)20(25)23-17-8-10-24(11-9-17)21(26)15-4-3-5-16(22)12-15/h3-7,12-13,17H,8-11H2,1-2H3,(H,23,25) |
| InChIKey | VUOGMEXCKHQANJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |