C23H32N2O4 — CID 108935727
(E)-3-cyclohexyl-N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]prop-2-enamide (PubChem CID 108935727) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is (E)-3-cyclohexyl-N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]prop-2-enamide.
| Compound Name | (E)-3-cyclohexyl-N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108935727 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | (E)-3-cyclohexyl-N-[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]prop-2-enamide |
| SMILES | COc1ccc(C(=O)N2CCC(NC(=O)/C=C/C3CCCCC3)CC2)cc1OC |
| InChI | InChI=1S/C23H32N2O4/c1-28-20-10-9-18(16-21(20)29-2)23(27)25-14-12-19(13-15-25)24-22(26)11-8-17-6-4-3-5-7-17/h8-11,16-17,19H,3-7,12-15H2,1-2H3,(H,24,26)/b11-8+ |
| InChIKey | OHLOGCHBAKUBDR-DHZHZOJOSA-N |
| XLogP | 3.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|