C20H28N2O4 — CID 108935169
N-[2-[[(E)-3-cyclohexylprop-2-enoyl]amino]ethyl]-3,4-dimethoxybenzamide (PubChem CID 108935169) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is N-[2-[[(E)-3-cyclohexylprop-2-enoyl]amino]ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[[(E)-3-cyclohexylprop-2-enoyl]amino]ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 108935169 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[2-[[(E)-3-cyclohexylprop-2-enoyl]amino]ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)/C=C/C2CCCCC2)cc1OC |
| InChI | InChI=1S/C20H28N2O4/c1-25-17-10-9-16(14-18(17)26-2)20(24)22-13-12-21-19(23)11-8-15-6-4-3-5-7-15/h8-11,14-15H,3-7,12-13H2,1-2H3,(H,21,23)(H,22,24)/b11-8+ |
| InChIKey | HBQUGVLJTLBXFP-DHZHZOJOSA-N |
| XLogP | 2.69 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|