About N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide
N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide (PubChem CID 38335556) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide |
| PubChem CID | 38335556 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCC2CCCC2)cc1OC |
| InChI | InChI=1S/C17H25NO3/c1-20-15-10-9-14(12-16(15)21-2)17(19)18-11-5-8-13-6-3-4-7-13/h9-10,12-13H,3-8,11H2,1-2H3,(H,18,19) |
| InChIKey | BQDRDKKFRKVHHQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide?
The IUPAC name of N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide (CID 38335556) is N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide.
What is the SMILES notation for N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide?
The canonical SMILES for N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide is COc1ccc(C(=O)NCCCC2CCCC2)cc1OC.
What is the InChIKey of N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide?
The InChIKey is BQDRDKKFRKVHHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO3/c1-20-15-10-9-14(12-16(15)21-2)17(19)18-11-5-8-13-6-3-4-7-13/h9-10,12-13H,3-8,11H2,1-2H3,(H,18,19).
What are the key properties of N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide?
N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide has a molecular weight of 291.39 g/mol, XLogP of 3.40, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyclopentylpropyl)-3,4-dimethoxybenzamide is sourced from PubChem (CID 38335556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).