C17H26N2O5S — CID 7618852
N-[2-(cyclohexylsulfamoyl)ethyl]-3,4-dimethoxybenzamide (PubChem CID 7618852) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-[2-(cyclohexylsulfamoyl)ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-(cyclohexylsulfamoyl)ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 7618852 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-[2-(cyclohexylsulfamoyl)ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCS(=O)(=O)NC2CCCCC2)cc1OC |
| InChI | InChI=1S/C17H26N2O5S/c1-23-15-9-8-13(12-16(15)24-2)17(20)18-10-11-25(21,22)19-14-6-4-3-5-7-14/h8-9,12,14,19H,3-7,10-11H2,1-2H3,(H,18,20) |
| InChIKey | MOECVZQUUXHJCV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |