C15H25N3O5S — CID 7618827
N-[2-[2-(dimethylamino)ethylsulfamoyl]ethyl]-3,4-dimethoxybenzamide (PubChem CID 7618827) has the molecular formula C15H25N3O5S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethylsulfamoyl]ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[2-(dimethylamino)ethylsulfamoyl]ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 7618827 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethylsulfamoyl]ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCS(=O)(=O)NCCN(C)C)cc1OC |
| InChI | InChI=1S/C15H25N3O5S/c1-18(2)9-7-17-24(20,21)10-8-16-15(19)12-5-6-13(22-3)14(11-12)23-4/h5-6,11,17H,7-10H2,1-4H3,(H,16,19) |
| InChIKey | LVNKFGPMFMBTAG-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |