C15H25N3O4S — CID 7618197
N-[2-[3-(dimethylamino)propylsulfamoyl]ethyl]-4-methoxybenzamide (PubChem CID 7618197) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[2-[3-(dimethylamino)propylsulfamoyl]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[3-(dimethylamino)propylsulfamoyl]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 7618197 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[2-[3-(dimethylamino)propylsulfamoyl]ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCS(=O)(=O)NCCCN(C)C)cc1 |
| InChI | InChI=1S/C15H25N3O4S/c1-18(2)11-4-9-17-23(20,21)12-10-16-15(19)13-5-7-14(22-3)8-6-13/h5-8,17H,4,9-12H2,1-3H3,(H,16,19) |
| InChIKey | LZWPIBFSWPQCNJ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|