C16H26N3O5S+ — CID 7618207
4-methoxy-N-[2-(2-morpholin-4-ium-4-ylethylsulfamoyl)ethyl]benzamide (PubChem CID 7618207) has the molecular formula C16H26N3O5S+ and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-methoxy-N-[2-(2-morpholin-4-ium-4-ylethylsulfamoyl)ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-(2-morpholin-4-ium-4-ylethylsulfamoyl)ethyl]benzamide |
|---|---|
| PubChem CID | 7618207 |
| Molecular Formula | C16H26N3O5S+ |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-methoxy-N-[2-(2-morpholin-4-ium-4-ylethylsulfamoyl)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCS(=O)(=O)NCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C16H25N3O5S/c1-23-15-4-2-14(3-5-15)16(20)17-7-13-25(21,22)18-6-8-19-9-11-24-12-10-19/h2-5,18H,6-13H2,1H3,(H,17,20)/p+1 |
| InChIKey | VISRQQXXYDUATO-UHFFFAOYSA-O |
| XLogP | -1.74 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |