C24H32N4O7S2 — CID 44961219
N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 44961219) has the molecular formula C24H32N4O7S2 and a molecular weight of 552.68 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 44961219 |
| Molecular Formula | C24H32N4O7S2 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)CCNC(=O)c3ccc(S(=O)(=O)N4CCOCC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H32N4O7S2/c1-34-22-6-4-21(5-7-22)26-11-13-27(14-12-26)36(30,31)19-10-25-24(29)20-2-8-23(9-3-20)37(32,33)28-15-17-35-18-16-28/h2-9H,10-19H2,1H3,(H,25,29) |
| InChIKey | PLOIIEJHSVWJKV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|