C22H29N3O6S — CID 22578878
2-(4-methoxyphenoxy)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]acetamide (PubChem CID 22578878) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]acetamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]acetamide |
|---|---|
| PubChem CID | 22578878 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]acetamide |
| SMILES | COc1ccc(OCC(=O)NCCS(=O)(=O)N2CCN(c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H29N3O6S/c1-29-19-5-3-18(4-6-19)24-12-14-25(15-13-24)32(27,28)16-11-23-22(26)17-31-21-9-7-20(30-2)8-10-21/h3-10H,11-17H2,1-2H3,(H,23,26) |
| InChIKey | VWHKNGBSYMFZML-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|