C28H33N3O4S — CID 41349450
N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]-3,3-diphenylpropanamide (PubChem CID 41349450) has the molecular formula C28H33N3O4S and a molecular weight of 507.66 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]-3,3-diphenylpropanamide.
| Compound Name | N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 41349450 |
| Molecular Formula | C28H33N3O4S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]-3,3-diphenylpropanamide |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)CCNC(=O)CC(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H33N3O4S/c1-35-26-14-12-25(13-15-26)30-17-19-31(20-18-30)36(33,34)21-16-29-28(32)22-27(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-15,27H,16-22H2,1H3,(H,29,32) |
| InChIKey | VPPGGXSQZYKEJK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|