C28H32FN3O3S — CID 42175427
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylpropyl]-3,3-diphenylpropanamide (PubChem CID 42175427) has the molecular formula C28H32FN3O3S and a molecular weight of 509.65 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylpropyl]-3,3-diphenylpropanamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylpropyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 42175427 |
| Molecular Formula | C28H32FN3O3S |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylpropyl]-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)NCCCS(=O)(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H32FN3O3S/c29-25-12-14-26(15-13-25)31-17-19-32(20-18-31)36(34,35)21-7-16-30-28(33)22-27(23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-6,8-15,27H,7,16-22H2,(H,30,33) |
| InChIKey | LZZLIKSMIDPVKA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|