C20H23F2N3O4S — CID 18565428
2-(4-fluorophenoxy)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylethyl]acetamide (PubChem CID 18565428) has the molecular formula C20H23F2N3O4S and a molecular weight of 439.48 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylethyl]acetamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylethyl]acetamide |
|---|---|
| PubChem CID | 18565428 |
| Molecular Formula | C20H23F2N3O4S |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylethyl]acetamide |
| SMILES | O=C(COc1ccc(F)cc1)NCCS(=O)(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H23F2N3O4S/c21-16-1-5-18(6-2-16)24-10-12-25(13-11-24)30(27,28)14-9-23-20(26)15-29-19-7-3-17(22)4-8-19/h1-8H,9-15H2,(H,23,26) |
| InChIKey | ZIBYJGOKWRGMAR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |