C21H26FN3O3S — CID 42175274
2-(4-fluorophenyl)-N-[3-(4-phenylpiperazin-1-yl)sulfonylpropyl]acetamide (PubChem CID 42175274) has the molecular formula C21H26FN3O3S and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[3-(4-phenylpiperazin-1-yl)sulfonylpropyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[3-(4-phenylpiperazin-1-yl)sulfonylpropyl]acetamide |
|---|---|
| PubChem CID | 42175274 |
| Molecular Formula | C21H26FN3O3S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[3-(4-phenylpiperazin-1-yl)sulfonylpropyl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)NCCCS(=O)(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26FN3O3S/c22-19-9-7-18(8-10-19)17-21(26)23-11-4-16-29(27,28)25-14-12-24(13-15-25)20-5-2-1-3-6-20/h1-3,5-10H,4,11-17H2,(H,23,26) |
| InChIKey | QLOUQKDKTLPKSA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|