C27H30FN3O3S — CID 42175567
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylpropyl]-2-(4-phenylphenyl)acetamide (PubChem CID 42175567) has the molecular formula C27H30FN3O3S and a molecular weight of 495.62 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylpropyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylpropyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 42175567 |
| Molecular Formula | C27H30FN3O3S |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylpropyl]-2-(4-phenylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)NCCCS(=O)(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H30FN3O3S/c28-25-9-4-5-10-26(25)30-16-18-31(19-17-30)35(33,34)20-6-15-29-27(32)21-22-11-13-24(14-12-22)23-7-2-1-3-8-23/h1-5,7-14H,6,15-21H2,(H,29,32) |
| InChIKey | YRCJUJPACNDCTK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|