C20H22Cl2FN3O3S — CID 42175526
2,5-dichloro-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylpropyl]benzamide (PubChem CID 42175526) has the molecular formula C20H22Cl2FN3O3S and a molecular weight of 474.39 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylpropyl]benzamide.
| Compound Name | 2,5-dichloro-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylpropyl]benzamide |
|---|---|
| PubChem CID | 42175526 |
| Molecular Formula | C20H22Cl2FN3O3S |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 2,5-dichloro-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylpropyl]benzamide |
| SMILES | O=C(NCCCS(=O)(=O)N1CCN(c2ccccc2F)CC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H22Cl2FN3O3S/c21-15-6-7-17(22)16(14-15)20(27)24-8-3-13-30(28,29)26-11-9-25(10-12-26)19-5-2-1-4-18(19)23/h1-2,4-7,14H,3,8-13H2,(H,24,27) |
| InChIKey | NRMIFJZUCBOOIJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|