C20H23Cl2N3O — CID 42224466
2,5-dichloro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide (PubChem CID 42224466) has the molecular formula C20H23Cl2N3O and a molecular weight of 392.33 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 2,5-dichloro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 42224466 |
| Molecular Formula | C20H23Cl2N3O |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2,5-dichloro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2)CC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H23Cl2N3O/c21-16-7-8-19(22)18(15-16)20(26)23-9-4-10-24-11-13-25(14-12-24)17-5-2-1-3-6-17/h1-3,5-8,15H,4,9-14H2,(H,23,26) |
| InChIKey | ULXMUCMIFLBLKX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|