C20H22Cl3N3O — CID 42273536
3,4-dichloro-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]benzamide (PubChem CID 42273536) has the molecular formula C20H22Cl3N3O and a molecular weight of 426.78 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 42273536 |
| Molecular Formula | C20H22Cl3N3O |
| Molecular Weight | 426.78 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 3,4-dichloro-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]benzamide |
| SMILES | O=C(NCCCN1CCN(c2ccc(Cl)cc2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H22Cl3N3O/c21-16-3-5-17(6-4-16)26-12-10-25(11-13-26)9-1-8-24-20(27)15-2-7-18(22)19(23)14-15/h2-7,14H,1,8-13H2,(H,24,27) |
| InChIKey | GPYDXUCDJDIUNZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.78 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|