C21H25Cl2N3O — CID 16889710
3,4-dichloro-N-[3-[4-(4-methylpiperazin-1-yl)phenyl]propyl]benzamide (PubChem CID 16889710) has the molecular formula C21H25Cl2N3O and a molecular weight of 406.36 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[4-(4-methylpiperazin-1-yl)phenyl]propyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[4-(4-methylpiperazin-1-yl)phenyl]propyl]benzamide |
|---|---|
| PubChem CID | 16889710 |
| Molecular Formula | C21H25Cl2N3O |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 3,4-dichloro-N-[3-[4-(4-methylpiperazin-1-yl)phenyl]propyl]benzamide |
| SMILES | CN1CCN(c2ccc(CCCNC(=O)c3ccc(Cl)c(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C21H25Cl2N3O/c1-25-11-13-26(14-12-25)18-7-4-16(5-8-18)3-2-10-24-21(27)17-6-9-19(22)20(23)15-17/h4-9,15H,2-3,10-14H2,1H3,(H,24,27) |
| InChIKey | TUJKVHHSBWHPJU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|