C20H22Cl2FN3O — CID 33136012
2,4-dichloro-5-fluoro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide (PubChem CID 33136012) has the molecular formula C20H22Cl2FN3O and a molecular weight of 410.32 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 33136012 |
| Molecular Formula | C20H22Cl2FN3O |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2)CC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl2FN3O/c21-17-14-18(22)19(23)13-16(17)20(27)24-7-4-8-25-9-11-26(12-10-25)15-5-2-1-3-6-15/h1-3,5-6,13-14H,4,7-12H2,(H,24,27) |
| InChIKey | LNXOJEUXBBPGSC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|