C20H21ClF2N4O2 — CID 26523820
2-chloro-4,5-difluoro-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]benzohydrazide (PubChem CID 26523820) has the molecular formula C20H21ClF2N4O2 and a molecular weight of 422.86 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]benzohydrazide.
| Compound Name | 2-chloro-4,5-difluoro-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 26523820 |
| Molecular Formula | C20H21ClF2N4O2 |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-chloro-4,5-difluoro-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]benzohydrazide |
| SMILES | O=C(CCN1CCN(c2ccccc2)CC1)NNC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C20H21ClF2N4O2/c21-16-13-18(23)17(22)12-15(16)20(29)25-24-19(28)6-7-26-8-10-27(11-9-26)14-4-2-1-3-5-14/h1-5,12-13H,6-11H2,(H,24,28)(H,25,29) |
| InChIKey | BJUXQDQKOHDNCM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|