C19H24N4O2S — CID 24979593
3-methyl-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]thiophene-2-carbohydrazide (PubChem CID 24979593) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-methyl-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]thiophene-2-carbohydrazide.
| Compound Name | 3-methyl-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 24979593 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-methyl-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]thiophene-2-carbohydrazide |
| SMILES | Cc1ccsc1C(=O)NNC(=O)CCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H24N4O2S/c1-15-8-14-26-18(15)19(25)21-20-17(24)7-9-22-10-12-23(13-11-22)16-5-3-2-4-6-16/h2-6,8,14H,7,9-13H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | CZUGZYZPJNHOOB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|