C26H32N6O2 — CID 26245753
1-benzyl-3,5-dimethyl-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]pyrazole-4-carbohydrazide (PubChem CID 26245753) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 1-benzyl-3,5-dimethyl-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]pyrazole-4-carbohydrazide.
| Compound Name | 1-benzyl-3,5-dimethyl-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 26245753 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 1-benzyl-3,5-dimethyl-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]pyrazole-4-carbohydrazide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1C(=O)NNC(=O)CCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N6O2/c1-20-25(21(2)32(29-20)19-22-9-5-3-6-10-22)26(34)28-27-24(33)13-14-30-15-17-31(18-16-30)23-11-7-4-8-12-23/h3-12H,13-19H2,1-2H3,(H,27,33)(H,28,34) |
| InChIKey | MXNYSGKJGHZJDF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|