C19H20N4O3 — CID 7601278
1-benzyl-3,5-dimethyl-N'-(2-methylfuran-3-carbonyl)pyrazole-4-carbohydrazide (PubChem CID 7601278) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-benzyl-3,5-dimethyl-N'-(2-methylfuran-3-carbonyl)pyrazole-4-carbohydrazide.
| Compound Name | 1-benzyl-3,5-dimethyl-N'-(2-methylfuran-3-carbonyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 7601278 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-benzyl-3,5-dimethyl-N'-(2-methylfuran-3-carbonyl)pyrazole-4-carbohydrazide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1C(=O)NNC(=O)c1ccoc1C |
| InChI | InChI=1S/C19H20N4O3/c1-12-17(13(2)23(22-12)11-15-7-5-4-6-8-15)19(25)21-20-18(24)16-9-10-26-14(16)3/h4-10H,11H2,1-3H3,(H,20,24)(H,21,25) |
| InChIKey | HZEVPNCVKBHQJS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|