C23H27N5OS — CID 9271798
1-[(1-benzyl-3,5-dimethylpyrazole-4-carbonyl)amino]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 9271798) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is 1-[(1-benzyl-3,5-dimethylpyrazole-4-carbonyl)amino]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[(1-benzyl-3,5-dimethylpyrazole-4-carbonyl)amino]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 9271798 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 1-[(1-benzyl-3,5-dimethylpyrazole-4-carbonyl)amino]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1C(=O)NNC(=S)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C23H27N5OS/c1-15(2)19-10-12-20(13-11-19)24-23(30)26-25-22(29)21-16(3)27-28(17(21)4)14-18-8-6-5-7-9-18/h5-13,15H,14H2,1-4H3,(H,25,29)(H2,24,26,30) |
| InChIKey | HUMGNOHRLZCJLI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|