C22H24Cl2N4S — CID 19677717
1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 19677717) has the molecular formula C22H24Cl2N4S and a molecular weight of 447.44 g/mol. Its IUPAC name is 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 19677717 |
| Molecular Formula | C22H24Cl2N4S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | Cc1nn(Cc2ccc(Cl)c(Cl)c2)c(C)c1NC(=S)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H24Cl2N4S/c1-13(2)17-6-8-18(9-7-17)25-22(29)26-21-14(3)27-28(15(21)4)12-16-5-10-19(23)20(24)11-16/h5-11,13H,12H2,1-4H3,(H2,25,26,29) |
| InChIKey | AAIWHHJZFXNRRA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|