C20H20Cl2N4S — CID 19342550
1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(3-methylphenyl)thiourea (PubChem CID 19342550) has the molecular formula C20H20Cl2N4S and a molecular weight of 419.38 g/mol. Its IUPAC name is 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 19342550 |
| Molecular Formula | C20H20Cl2N4S |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(3-methylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)Nc2c(C)nn(Cc3ccc(Cl)c(Cl)c3)c2C)c1 |
| InChI | InChI=1S/C20H20Cl2N4S/c1-12-5-4-6-16(9-12)23-20(27)24-19-13(2)25-26(14(19)3)11-15-7-8-17(21)18(22)10-15/h4-10H,11H2,1-3H3,(H2,23,24,27) |
| InChIKey | CUPOSIZJIWIIGI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|