C21H20Cl2N4OS — CID 19677738
1-(4-acetylphenyl)-3-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19677738) has the molecular formula C21H20Cl2N4OS and a molecular weight of 447.39 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-(4-acetylphenyl)-3-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19677738 |
| Molecular Formula | C21H20Cl2N4OS |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2c(C)nn(Cc3ccc(Cl)c(Cl)c3)c2C)cc1 |
| InChI | InChI=1S/C21H20Cl2N4OS/c1-12-20(25-21(29)24-17-7-5-16(6-8-17)14(3)28)13(2)27(26-12)11-15-4-9-18(22)19(23)10-15/h4-10H,11H2,1-3H3,(H2,24,25,29) |
| InChIKey | BNKIWORRIALNBY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|