C17H22Cl2N4S — CID 19342568
1-butyl-3-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19342568) has the molecular formula C17H22Cl2N4S and a molecular weight of 385.36 g/mol. Its IUPAC name is 1-butyl-3-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-butyl-3-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19342568 |
| Molecular Formula | C17H22Cl2N4S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-butyl-3-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | CCCCNC(=S)Nc1c(C)nn(Cc2ccc(Cl)c(Cl)c2)c1C |
| InChI | InChI=1S/C17H22Cl2N4S/c1-4-5-8-20-17(24)21-16-11(2)22-23(12(16)3)10-13-6-7-14(18)15(19)9-13/h6-7,9H,4-5,8,10H2,1-3H3,(H2,20,21,24) |
| InChIKey | XSTBJCKNANLSQO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|