C20H24Cl2N6S — CID 19334409
1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(3-methylpyrazol-1-yl)propyl]thiourea (PubChem CID 19334409) has the molecular formula C20H24Cl2N6S and a molecular weight of 451.43 g/mol. Its IUPAC name is 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(3-methylpyrazol-1-yl)propyl]thiourea.
| Compound Name | 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(3-methylpyrazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 19334409 |
| Molecular Formula | C20H24Cl2N6S |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(3-methylpyrazol-1-yl)propyl]thiourea |
| SMILES | Cc1ccn(CCCNC(=S)Nc2c(C)nn(Cc3ccc(Cl)c(Cl)c3)c2C)n1 |
| InChI | InChI=1S/C20H24Cl2N6S/c1-13-7-10-27(25-13)9-4-8-23-20(29)24-19-14(2)26-28(15(19)3)12-16-5-6-17(21)18(22)11-16/h5-7,10-11H,4,8-9,12H2,1-3H3,(H2,23,24,29) |
| InChIKey | SAXPXCCFTFWQRC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|