C19H22Cl2N6S — CID 19571916
1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[(1-ethylpyrazol-3-yl)methyl]thiourea (PubChem CID 19571916) has the molecular formula C19H22Cl2N6S and a molecular weight of 437.40 g/mol. Its IUPAC name is 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[(1-ethylpyrazol-3-yl)methyl]thiourea.
| Compound Name | 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[(1-ethylpyrazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19571916 |
| Molecular Formula | C19H22Cl2N6S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[(1-ethylpyrazol-3-yl)methyl]thiourea |
| SMILES | CCn1ccc(CNC(=S)Nc2c(C)nn(Cc3ccc(Cl)c(Cl)c3)c2C)n1 |
| InChI | InChI=1S/C19H22Cl2N6S/c1-4-26-8-7-15(25-26)10-22-19(28)23-18-12(2)24-27(13(18)3)11-14-5-6-16(20)17(21)9-14/h5-9H,4,10-11H2,1-3H3,(H2,22,23,28) |
| InChIKey | MYZXYWJJULJJGO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|