C16H18Cl2N4S — CID 19677742
1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-prop-2-enylthiourea (PubChem CID 19677742) has the molecular formula C16H18Cl2N4S and a molecular weight of 369.32 g/mol. Its IUPAC name is 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 19677742 |
| Molecular Formula | C16H18Cl2N4S |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1c(C)nn(Cc2ccc(Cl)c(Cl)c2)c1C |
| InChI | InChI=1S/C16H18Cl2N4S/c1-4-7-19-16(23)20-15-10(2)21-22(11(15)3)9-12-5-6-13(17)14(18)8-12/h4-6,8H,1,7,9H2,2-3H3,(H2,19,20,23) |
| InChIKey | CZUNJUDKYSTLBZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|