C20H19Cl3N4S — CID 19677728
1-(5-chloro-2-methylphenyl)-3-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19677728) has the molecular formula C20H19Cl3N4S and a molecular weight of 453.83 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-(5-chloro-2-methylphenyl)-3-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19677728 |
| Molecular Formula | C20H19Cl3N4S |
| Molecular Weight | 453.83 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | Cc1ccc(Cl)cc1NC(=S)Nc1c(C)nn(Cc2ccc(Cl)c(Cl)c2)c1C |
| InChI | InChI=1S/C20H19Cl3N4S/c1-11-4-6-15(21)9-18(11)24-20(28)25-19-12(2)26-27(13(19)3)10-14-5-7-16(22)17(23)8-14/h4-9H,10H2,1-3H3,(H2,24,25,28) |
| InChIKey | MQZPSWIGXLTHPU-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.83 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|