C21H27ClN6S — CID 19344624
1-[1-[(3-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiourea (PubChem CID 19344624) has the molecular formula C21H27ClN6S and a molecular weight of 431.01 g/mol. Its IUPAC name is 1-[1-[(3-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiourea.
| Compound Name | 1-[1-[(3-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 19344624 |
| Molecular Formula | C21H27ClN6S |
| Molecular Weight | 431.01 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-[1-[(3-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiourea |
| SMILES | Cc1cc(C)n(CCCNC(=S)Nc2c(C)nn(Cc3cccc(Cl)c3)c2C)n1 |
| InChI | InChI=1S/C21H27ClN6S/c1-14-11-15(2)27(25-14)10-6-9-23-21(29)24-20-16(3)26-28(17(20)4)13-18-7-5-8-19(22)12-18/h5,7-8,11-12H,6,9-10,13H2,1-4H3,(H2,23,24,29) |
| InChIKey | SFMGRXOXXKNKLF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.01 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|