C21H26BrFN6S — CID 19573129
1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19573129) has the molecular formula C21H26BrFN6S and a molecular weight of 493.45 g/mol. Its IUPAC name is 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19573129 |
| Molecular Formula | C21H26BrFN6S |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | Cc1nn(CCCNC(=S)Nc2c(C)nn(Cc3ccc(F)cc3)c2C)c(C)c1Br |
| InChI | InChI=1S/C21H26BrFN6S/c1-13-19(22)15(3)28(26-13)11-5-10-24-21(30)25-20-14(2)27-29(16(20)4)12-17-6-8-18(23)9-7-17/h6-9H,5,10-12H2,1-4H3,(H2,24,25,30) |
| InChIKey | OUMQMCQIFOFZLN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|