C21H23FN4S — CID 19342478
1-(4-ethylphenyl)-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19342478) has the molecular formula C21H23FN4S and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19342478 |
| Molecular Formula | C21H23FN4S |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | CCc1ccc(NC(=S)Nc2c(C)nn(Cc3ccc(F)cc3)c2C)cc1 |
| InChI | InChI=1S/C21H23FN4S/c1-4-16-7-11-19(12-8-16)23-21(27)24-20-14(2)25-26(15(20)3)13-17-5-9-18(22)10-6-17/h5-12H,4,13H2,1-3H3,(H2,23,24,27) |
| InChIKey | RIXGOZDCNMAWGF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|