C20H21FN4S — CID 19677964
1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 19677964) has the molecular formula C20H21FN4S and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 19677964 |
| Molecular Formula | C20H21FN4S |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=S)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN4S/c1-14-19(15(2)25(24-14)13-17-6-4-3-5-7-17)23-20(26)22-12-16-8-10-18(21)11-9-16/h3-11H,12-13H2,1-2H3,(H2,22,23,26) |
| InChIKey | XOOPMMWYXXNDRQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|