C18H23FN4S — CID 2211968
1-cyclopentyl-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 2211968) has the molecular formula C18H23FN4S and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-cyclopentyl-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-cyclopentyl-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 2211968 |
| Molecular Formula | C18H23FN4S |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-cyclopentyl-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(C)c1NC(=S)NC1CCCC1 |
| InChI | InChI=1S/C18H23FN4S/c1-12-17(21-18(24)20-16-5-3-4-6-16)13(2)23(22-12)11-14-7-9-15(19)10-8-14/h7-10,16H,3-6,11H2,1-2H3,(H2,20,21,24) |
| InChIKey | IKTKOSYJMBCPBZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|