C19H20FN5O2S2 — CID 19677153
1-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 19677153) has the molecular formula C19H20FN5O2S2 and a molecular weight of 433.53 g/mol. Its IUPAC name is 1-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 19677153 |
| Molecular Formula | C19H20FN5O2S2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 1-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(C)c1NC(=S)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H20FN5O2S2/c1-12-18(13(2)25(24-12)11-14-3-5-15(20)6-4-14)23-19(28)22-16-7-9-17(10-8-16)29(21,26)27/h3-10H,11H2,1-2H3,(H2,21,26,27)(H2,22,23,28) |
| InChIKey | HGOYMBUKGWYWED-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|