C24H25N7O2S2 — CID 19679458
1-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 19679458) has the molecular formula C24H25N7O2S2 and a molecular weight of 507.65 g/mol. Its IUPAC name is 1-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19679458 |
| Molecular Formula | C24H25N7O2S2 |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 1-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | Cc1ccc(Cn2nc(C)c(NC(=S)Nc3ccc(S(=O)(=O)Nc4ncccn4)cc3)c2C)cc1 |
| InChI | InChI=1S/C24H25N7O2S2/c1-16-5-7-19(8-6-16)15-31-18(3)22(17(2)29-31)28-24(34)27-20-9-11-21(12-10-20)35(32,33)30-23-25-13-4-14-26-23/h4-14H,15H2,1-3H3,(H,25,26,30)(H2,27,28,34) |
| InChIKey | LWDRNNUGXDBEGE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|