C14H17N5O2S2 — CID 2100953
1-propan-2-yl-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 2100953) has the molecular formula C14H17N5O2S2 and a molecular weight of 351.46 g/mol. Its IUPAC name is 1-propan-2-yl-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-propan-2-yl-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2100953 |
| Molecular Formula | C14H17N5O2S2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-propan-2-yl-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | CC(C)NC(=S)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C14H17N5O2S2/c1-10(2)17-14(22)18-11-4-6-12(7-5-11)23(20,21)19-13-15-8-3-9-16-13/h3-10H,1-2H3,(H,15,16,19)(H2,17,18,22) |
| InChIKey | WAWMBQAGURAIPY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|