C17H21N5O3S2 — CID 2209033
(2R,6R)-2,6-dimethyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]morpholine-4-carbothioamide (PubChem CID 2209033) has the molecular formula C17H21N5O3S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]morpholine-4-carbothioamide.
| Compound Name | (2R,6R)-2,6-dimethyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 2209033 |
| Molecular Formula | C17H21N5O3S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]morpholine-4-carbothioamide |
| SMILES | C[C@@H]1CN(C(=S)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C17H21N5O3S2/c1-12-10-22(11-13(2)25-12)17(26)20-14-4-6-15(7-5-14)27(23,24)21-16-18-8-3-9-19-16/h3-9,12-13H,10-11H2,1-2H3,(H,20,26)(H,18,19,21)/t12-,13-/m1/s1 |
| InChIKey | LLIVUENUKHJEGG-CHWSQXEVSA-N |
| XLogP | 2.08 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|