C28H31N9O4S2 — CID 158881281
4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]piperazine-1-carbothioamide;methane (PubChem CID 158881281) has the molecular formula C28H31N9O4S2 and a molecular weight of 621.75 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]piperazine-1-carbothioamide;methane.
| Compound Name | 4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]piperazine-1-carbothioamide;methane |
|---|---|
| PubChem CID | 158881281 |
| Molecular Formula | C28H31N9O4S2 |
| Molecular Weight | 621.75 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | 4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]piperazine-1-carbothioamide;methane |
| SMILES | C.COc1cc2[nH]c3ncnc(N4CCN(C(=S)Nc5ccc(S(=O)(=O)Nc6ncccn6)cc5)CC4)c3c2cc1OC |
| InChI | InChI=1S/C27H27N9O4S2.CH4/c1-39-21-14-19-20(15-22(21)40-2)33-24-23(19)25(31-16-30-24)35-10-12-36(13-11-35)27(41)32-17-4-6-18(7-5-17)42(37,38)34-26-28-8-3-9-29-26;/h3-9,14-16H,10-13H2,1-2H3,(H,32,41)(H,28,29,34)(H,30,31,33);1H4 |
| InChIKey | JDBAYRYMLFJZPX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 150.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.75 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|