C31H29F2N7O6S2 — CID 59784119
4-(difluoromethoxy)-N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonylbenzamide (PubChem CID 59784119) has the molecular formula C31H29F2N7O6S2 and a molecular weight of 697.75 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonylbenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 59784119 |
| Molecular Formula | C31H29F2N7O6S2 |
| Molecular Weight | 697.75 g/mol |
| Exact Mass | 697.16 |
| IUPAC Name | 4-(difluoromethoxy)-N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonylbenzamide |
| SMILES | COc1cc2[nH]c3ncnc(N4CCN(C(=S)Nc5ccc(S(=O)(=O)NC(=O)c6ccc(OC(F)F)cc6)cc5)CC4)c3c2cc1OC |
| InChI | InChI=1S/C31H29F2N7O6S2/c1-44-24-15-22-23(16-25(24)45-2)37-27-26(22)28(35-17-34-27)39-11-13-40(14-12-39)31(47)36-19-5-9-21(10-6-19)48(42,43)38-29(41)18-3-7-20(8-4-18)46-30(32)33/h3-10,15-17,30H,11-14H2,1-2H3,(H,36,47)(H,38,41)(H,34,35,37) |
| InChIKey | LGELYVNSJFIUAE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 151.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.75 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|