C30H30N7O6S2+ — CID 123329154
N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-3-ium-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonyl-4-hydroxybenzamide (PubChem CID 123329154) has the molecular formula C30H30N7O6S2+ and a molecular weight of 648.75 g/mol. Its IUPAC name is N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-3-ium-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonyl-4-hydroxybenzamide.
| Compound Name | N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-3-ium-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonyl-4-hydroxybenzamide |
|---|---|
| PubChem CID | 123329154 |
| Molecular Formula | C30H30N7O6S2+ |
| Molecular Weight | 648.75 g/mol |
| Exact Mass | 648.17 |
| IUPAC Name | N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-3-ium-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonyl-4-hydroxybenzamide |
| SMILES | COc1cc2[nH]c3nc[nH+]c(N4CCN(C(=S)Nc5ccc(S(=O)(=O)NC(=O)c6ccc(O)cc6)cc5)CC4)c3c2cc1OC |
| InChI | InChI=1S/C30H29N7O6S2/c1-42-24-15-22-23(16-25(24)43-2)34-27-26(22)28(32-17-31-27)36-11-13-37(14-12-36)30(44)33-19-5-9-21(10-6-19)45(40,41)35-29(39)18-3-7-20(38)8-4-18/h3-10,15-17,38H,11-14H2,1-2H3,(H,33,44)(H,35,39)(H,31,32,34)/p+1 |
| InChIKey | ZIPONPPBUVOMTD-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 163.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.75 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|